C41H39N3O4S — CID 19309886
N-[(E)-1-(2-ethoxyphenyl)-3-[3-[2-(2-ethyl-6-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19309886) has the molecular formula C41H39N3O4S and a molecular weight of 669.85 g/mol. Its IUPAC name is N-[(E)-1-(2-ethoxyphenyl)-3-[3-[2-(2-ethyl-6-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(2-ethoxyphenyl)-3-[3-[2-(2-ethyl-6-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19309886 |
| Molecular Formula | C41H39N3O4S |
| Molecular Weight | 669.85 g/mol |
| Exact Mass | 669.27 |
| IUPAC Name | N-[(E)-1-(2-ethoxyphenyl)-3-[3-[2-(2-ethyl-6-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCOc1ccccc1/C=C(/NC(=O)c1ccccc1)C(=O)Nc1cccc(SC(C(=O)Nc2c(C)cccc2CC)c2ccccc2)c1 |
| InChI | InChI=1S/C41H39N3O4S/c1-4-29-22-14-16-28(3)37(29)44-41(47)38(30-17-8-6-9-18-30)49-34-24-15-23-33(27-34)42-40(46)35(43-39(45)31-19-10-7-11-20-31)26-32-21-12-13-25-36(32)48-5-2/h6-27,38H,4-5H2,1-3H3,(H,42,46)(H,43,45)(H,44,47)/b35-26+ |
| InChIKey | SIUWYLIGIVIQKE-MDAYZVFASA-N |
| XLogP | 8.84 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.85 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|