C45H39N3O3S — CID 19312766
N-[(E)-3-[3-[2-(2-ethyl-6-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(4-phenylphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19312766) has the molecular formula C45H39N3O3S and a molecular weight of 701.89 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-(2-ethyl-6-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(4-phenylphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-(2-ethyl-6-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(4-phenylphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19312766 |
| Molecular Formula | C45H39N3O3S |
| Molecular Weight | 701.89 g/mol |
| Exact Mass | 701.27 |
| IUPAC Name | N-[(E)-3-[3-[2-(2-ethyl-6-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(4-phenylphenyl)prop-1-en-2-yl]benzamide |
| SMILES | CCc1cccc(C)c1NC(=O)C(Sc1cccc(NC(=O)/C(=C\c2ccc(-c3ccccc3)cc2)NC(=O)c2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C45H39N3O3S/c1-3-33-22-13-15-31(2)41(33)48-45(51)42(36-18-9-5-10-19-36)52-39-24-14-23-38(30-39)46-44(50)40(47-43(49)37-20-11-6-12-21-37)29-32-25-27-35(28-26-32)34-16-7-4-8-17-34/h4-30,42H,3H2,1-2H3,(H,46,50)(H,47,49)(H,48,51)/b40-29+ |
| InChIKey | UMEFMVMCYURYMW-JVFAEYSFSA-N |
| XLogP | 10.11 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.89 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|