C41H32N4O3S — CID 19320876
N-[(E)-3-oxo-3-[3-[2-oxo-1-phenyl-2-(pyridin-4-ylamino)ethyl]sulfanylanilino]-1-(4-phenylphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19320876) has the molecular formula C41H32N4O3S and a molecular weight of 660.80 g/mol. Its IUPAC name is N-[(E)-3-oxo-3-[3-[2-oxo-1-phenyl-2-(pyridin-4-ylamino)ethyl]sulfanylanilino]-1-(4-phenylphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-oxo-3-[3-[2-oxo-1-phenyl-2-(pyridin-4-ylamino)ethyl]sulfanylanilino]-1-(4-phenylphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19320876 |
| Molecular Formula | C41H32N4O3S |
| Molecular Weight | 660.80 g/mol |
| Exact Mass | 660.22 |
| IUPAC Name | N-[(E)-3-oxo-3-[3-[2-oxo-1-phenyl-2-(pyridin-4-ylamino)ethyl]sulfanylanilino]-1-(4-phenylphenyl)prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(SC(C(=O)Nc2ccncc2)c2ccccc2)c1)/C(=C\c1ccc(-c2ccccc2)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C41H32N4O3S/c46-39(33-15-8-3-9-16-33)45-37(27-29-19-21-31(22-20-29)30-11-4-1-5-12-30)40(47)44-35-17-10-18-36(28-35)49-38(32-13-6-2-7-14-32)41(48)43-34-23-25-42-26-24-34/h1-28,38H,(H,44,47)(H,45,46)(H,42,43,48)/b37-27+ |
| InChIKey | VTVWVUJBFXXRRI-NXEFEZKASA-N |
| XLogP | 8.63 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.80 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|