C44H35N3O5S — CID 19312770
methyl 2-[[2-[3-[[(E)-2-benzamido-3-(4-phenylphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate (PubChem CID 19312770) has the molecular formula C44H35N3O5S and a molecular weight of 717.85 g/mol. Its IUPAC name is methyl 2-[[2-[3-[[(E)-2-benzamido-3-(4-phenylphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[3-[[(E)-2-benzamido-3-(4-phenylphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 19312770 |
| Molecular Formula | C44H35N3O5S |
| Molecular Weight | 717.85 g/mol |
| Exact Mass | 717.23 |
| IUPAC Name | methyl 2-[[2-[3-[[(E)-2-benzamido-3-(4-phenylphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C(Sc1cccc(NC(=O)/C(=C\c2ccc(-c3ccccc3)cc2)NC(=O)c2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C44H35N3O5S/c1-52-44(51)37-22-11-12-23-38(37)46-43(50)40(33-16-7-3-8-17-33)53-36-21-13-20-35(29-36)45-42(49)39(47-41(48)34-18-9-4-10-19-34)28-30-24-26-32(27-25-30)31-14-5-2-6-15-31/h2-29,40H,1H3,(H,45,49)(H,46,50)(H,47,48)/b39-28+ |
| InChIKey | RGAGUKTVWWHXFZ-MULCNKJOSA-N |
| XLogP | 9.02 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.85 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|