C39H34ClN3O4S — CID 22187185
N-[(Z)-3-[4-[2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22187185) has the molecular formula C39H34ClN3O4S and a molecular weight of 676.24 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22187185 |
| Molecular Formula | C39H34ClN3O4S |
| Molecular Weight | 676.24 g/mol |
| Exact Mass | 675.20 |
| IUPAC Name | N-[(Z)-3-[4-[2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCOc1ccccc1/C=C(\NC(=O)c1ccccc1)C(=O)Nc1ccc(SC(C(=O)Nc2ccc(C)c(Cl)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C39H34ClN3O4S/c1-3-47-35-17-11-10-16-29(35)24-34(43-37(44)28-14-8-5-9-15-28)38(45)41-30-20-22-32(23-21-30)48-36(27-12-6-4-7-13-27)39(46)42-31-19-18-26(2)33(40)25-31/h4-25,36H,3H2,1-2H3,(H,41,45)(H,42,46)(H,43,44)/b34-24- |
| InChIKey | UGMLIPHXMQBLEH-BCJTWVECSA-N |
| XLogP | 8.93 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.24 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|