C40H37N3O4S — CID 22187405
N-[(Z)-3-[4-[2-(3,4-dimethylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(4-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22187405) has the molecular formula C40H37N3O4S and a molecular weight of 655.82 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(3,4-dimethylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(4-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(3,4-dimethylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(4-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22187405 |
| Molecular Formula | C40H37N3O4S |
| Molecular Weight | 655.82 g/mol |
| Exact Mass | 655.25 |
| IUPAC Name | N-[(Z)-3-[4-[2-(3,4-dimethylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(4-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCOc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SC(C(=O)Nc3ccc(C)c(C)c3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C40H37N3O4S/c1-4-47-34-21-16-29(17-22-34)26-36(43-38(44)31-13-9-6-10-14-31)39(45)41-32-19-23-35(24-20-32)48-37(30-11-7-5-8-12-30)40(46)42-33-18-15-27(2)28(3)25-33/h5-26,37H,4H2,1-3H3,(H,41,45)(H,42,46)(H,43,44)/b36-26- |
| InChIKey | CHAYEVLWHDEVMT-QYVLQNAGSA-N |
| XLogP | 8.58 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.82 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|