C37H32N4O4S — CID 19714456
N-[(Z)-1-(4-ethoxyphenyl)-3-oxo-3-[4-[2-oxo-1-phenyl-2-(pyridin-4-ylamino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19714456) has the molecular formula C37H32N4O4S and a molecular weight of 628.75 g/mol. Its IUPAC name is N-[(Z)-1-(4-ethoxyphenyl)-3-oxo-3-[4-[2-oxo-1-phenyl-2-(pyridin-4-ylamino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(4-ethoxyphenyl)-3-oxo-3-[4-[2-oxo-1-phenyl-2-(pyridin-4-ylamino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19714456 |
| Molecular Formula | C37H32N4O4S |
| Molecular Weight | 628.75 g/mol |
| Exact Mass | 628.21 |
| IUPAC Name | N-[(Z)-1-(4-ethoxyphenyl)-3-oxo-3-[4-[2-oxo-1-phenyl-2-(pyridin-4-ylamino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | CCOc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SC(C(=O)Nc3ccncc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C37H32N4O4S/c1-2-45-31-17-13-26(14-18-31)25-33(41-35(42)28-11-7-4-8-12-28)36(43)39-29-15-19-32(20-16-29)46-34(27-9-5-3-6-10-27)37(44)40-30-21-23-38-24-22-30/h3-25,34H,2H2,1H3,(H,39,43)(H,41,42)(H,38,40,44)/b33-25- |
| InChIKey | ZUNOJKIPKCALGT-IVQJCJPDSA-N |
| XLogP | 7.36 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.75 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|