C42H35N3O4S — CID 22187419
N-[(Z)-1-(4-ethoxyphenyl)-3-[4-[2-(naphthalen-1-ylamino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22187419) has the molecular formula C42H35N3O4S and a molecular weight of 677.83 g/mol. Its IUPAC name is N-[(Z)-1-(4-ethoxyphenyl)-3-[4-[2-(naphthalen-1-ylamino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(4-ethoxyphenyl)-3-[4-[2-(naphthalen-1-ylamino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22187419 |
| Molecular Formula | C42H35N3O4S |
| Molecular Weight | 677.83 g/mol |
| Exact Mass | 677.23 |
| IUPAC Name | N-[(Z)-1-(4-ethoxyphenyl)-3-[4-[2-(naphthalen-1-ylamino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCOc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SC(C(=O)Nc3cccc4ccccc34)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C42H35N3O4S/c1-2-49-34-24-20-29(21-25-34)28-38(45-40(46)32-15-7-4-8-16-32)41(47)43-33-22-26-35(27-23-33)50-39(31-13-5-3-6-14-31)42(48)44-37-19-11-17-30-12-9-10-18-36(30)37/h3-28,39H,2H2,1H3,(H,43,47)(H,44,48)(H,45,46)/b38-28- |
| InChIKey | OLQBDKGLGIGDBS-AWYAZMPSSA-N |
| XLogP | 9.12 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.83 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|