C40H30N4O5S — CID 22188679
N-[(Z)-3-[4-[2-(naphthalen-1-ylamino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22188679) has the molecular formula C40H30N4O5S and a molecular weight of 678.77 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(naphthalen-1-ylamino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(naphthalen-1-ylamino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22188679 |
| Molecular Formula | C40H30N4O5S |
| Molecular Weight | 678.77 g/mol |
| Exact Mass | 678.19 |
| IUPAC Name | N-[(Z)-3-[4-[2-(naphthalen-1-ylamino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SC(C(=O)Nc2cccc3ccccc23)c2ccccc2)cc1)/C(=C/c1ccc([N+](=O)[O-])cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C40H30N4O5S/c45-38(30-13-5-2-6-14-30)43-36(26-27-18-22-32(23-19-27)44(48)49)39(46)41-31-20-24-33(25-21-31)50-37(29-11-3-1-4-12-29)40(47)42-35-17-9-15-28-10-7-8-16-34(28)35/h1-26,37H,(H,41,46)(H,42,47)(H,43,45)/b36-26- |
| InChIKey | LFZXXWBMFYUTAR-QYVLQNAGSA-N |
| XLogP | 8.63 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.77 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|