C37H28N4O7S — CID 22188700
4-[[2-[4-[[(Z)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoic acid (PubChem CID 22188700) has the molecular formula C37H28N4O7S and a molecular weight of 672.72 g/mol. Its IUPAC name is 4-[[2-[4-[[(Z)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[4-[[(Z)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 22188700 |
| Molecular Formula | C37H28N4O7S |
| Molecular Weight | 672.72 g/mol |
| Exact Mass | 672.17 |
| IUPAC Name | 4-[[2-[4-[[(Z)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoic acid |
| SMILES | O=C(Nc1ccc(SC(C(=O)Nc2ccc(C(=O)O)cc2)c2ccccc2)cc1)/C(=C/c1ccc([N+](=O)[O-])cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C37H28N4O7S/c42-34(26-9-5-2-6-10-26)40-32(23-24-11-19-30(20-12-24)41(47)48)35(43)38-29-17-21-31(22-18-29)49-33(25-7-3-1-4-8-25)36(44)39-28-15-13-27(14-16-28)37(45)46/h1-23,33H,(H,38,43)(H,39,44)(H,40,42)(H,45,46)/b32-23- |
| InChIKey | ABWMEXPBUIQRKG-SJIPCVTESA-N |
| XLogP | 7.17 |
| TPSA | 167.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.72 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|