C38H29N5O5S — CID 19059354
N-[(Z)-1-(1H-indol-3-yl)-3-[4-[2-(4-nitroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19059354) has the molecular formula C38H29N5O5S and a molecular weight of 667.75 g/mol. Its IUPAC name is N-[(Z)-1-(1H-indol-3-yl)-3-[4-[2-(4-nitroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(1H-indol-3-yl)-3-[4-[2-(4-nitroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19059354 |
| Molecular Formula | C38H29N5O5S |
| Molecular Weight | 667.75 g/mol |
| Exact Mass | 667.19 |
| IUPAC Name | N-[(Z)-1-(1H-indol-3-yl)-3-[4-[2-(4-nitroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SC(C(=O)Nc2ccc([N+](=O)[O-])cc2)c2ccccc2)cc1)/C(=C/c1c[nH]c2ccccc12)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C38H29N5O5S/c44-36(26-11-5-2-6-12-26)42-34(23-27-24-39-33-14-8-7-13-32(27)33)37(45)40-29-17-21-31(22-18-29)49-35(25-9-3-1-4-10-25)38(46)41-28-15-19-30(20-16-28)43(47)48/h1-24,35,39H,(H,40,45)(H,41,46)(H,42,44)/b34-23- |
| InChIKey | ROCOCVDUKNEPLD-XSVYLIDLSA-N |
| XLogP | 7.96 |
| TPSA | 146.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.75 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|