C39H32N4O3S — CID 19059390
N-[(Z)-1-(1H-indol-3-yl)-3-[4-[2-(2-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19059390) has the molecular formula C39H32N4O3S and a molecular weight of 636.78 g/mol. Its IUPAC name is N-[(Z)-1-(1H-indol-3-yl)-3-[4-[2-(2-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(1H-indol-3-yl)-3-[4-[2-(2-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19059390 |
| Molecular Formula | C39H32N4O3S |
| Molecular Weight | 636.78 g/mol |
| Exact Mass | 636.22 |
| IUPAC Name | N-[(Z)-1-(1H-indol-3-yl)-3-[4-[2-(2-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1ccccc1NC(=O)C(Sc1ccc(NC(=O)/C(=C/c2c[nH]c3ccccc23)NC(=O)c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C39H32N4O3S/c1-26-12-8-10-18-33(26)42-39(46)36(27-13-4-2-5-14-27)47-31-22-20-30(21-23-31)41-38(45)35(43-37(44)28-15-6-3-7-16-28)24-29-25-40-34-19-11-9-17-32(29)34/h2-25,36,40H,1H3,(H,41,45)(H,42,46)(H,43,44)/b35-24- |
| InChIKey | NRCIQFHAFHFFTE-BGDIREAQSA-N |
| XLogP | 8.36 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.78 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|