C35H29N3O4S — CID 22188038
N-[(Z)-1-(furan-2-yl)-3-[4-[2-(2-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22188038) has the molecular formula C35H29N3O4S and a molecular weight of 587.70 g/mol. Its IUPAC name is N-[(Z)-1-(furan-2-yl)-3-[4-[2-(2-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(furan-2-yl)-3-[4-[2-(2-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22188038 |
| Molecular Formula | C35H29N3O4S |
| Molecular Weight | 587.70 g/mol |
| Exact Mass | 587.19 |
| IUPAC Name | N-[(Z)-1-(furan-2-yl)-3-[4-[2-(2-methylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1ccccc1NC(=O)C(Sc1ccc(NC(=O)/C(=C/c2ccco2)NC(=O)c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C35H29N3O4S/c1-24-11-8-9-17-30(24)37-35(41)32(25-12-4-2-5-13-25)43-29-20-18-27(19-21-29)36-34(40)31(23-28-16-10-22-42-28)38-33(39)26-14-6-3-7-15-26/h2-23,32H,1H3,(H,36,40)(H,37,41)(H,38,39)/b31-23- |
| InChIKey | NLISKIGZSZCBRE-SXBRIOAWSA-N |
| XLogP | 7.47 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.70 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|