C36H31N3O4S — CID 22188053
N-[(Z)-3-[4-[2-(2,6-dimethylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22188053) has the molecular formula C36H31N3O4S and a molecular weight of 601.73 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(2,6-dimethylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(2,6-dimethylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22188053 |
| Molecular Formula | C36H31N3O4S |
| Molecular Weight | 601.73 g/mol |
| Exact Mass | 601.20 |
| IUPAC Name | N-[(Z)-3-[4-[2-(2,6-dimethylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1cccc(C)c1NC(=O)C(Sc1ccc(NC(=O)/C(=C/c2ccco2)NC(=O)c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C36H31N3O4S/c1-24-11-9-12-25(2)32(24)39-36(42)33(26-13-5-3-6-14-26)44-30-20-18-28(19-21-30)37-35(41)31(23-29-17-10-22-43-29)38-34(40)27-15-7-4-8-16-27/h3-23,33H,1-2H3,(H,37,41)(H,38,40)(H,39,42)/b31-23- |
| InChIKey | JDKSYNLXQULERM-SXBRIOAWSA-N |
| XLogP | 7.78 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.73 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|