C36H29N3O6S — CID 22188080
3-[[2-[4-[[(Z)-2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-methylbenzoic acid (PubChem CID 22188080) has the molecular formula C36H29N3O6S and a molecular weight of 631.71 g/mol. Its IUPAC name is 3-[[2-[4-[[(Z)-2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-methylbenzoic acid.
| Compound Name | 3-[[2-[4-[[(Z)-2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 22188080 |
| Molecular Formula | C36H29N3O6S |
| Molecular Weight | 631.71 g/mol |
| Exact Mass | 631.18 |
| IUPAC Name | 3-[[2-[4-[[(Z)-2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1NC(=O)C(Sc1ccc(NC(=O)/C(=C/c2ccco2)NC(=O)c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C36H29N3O6S/c1-23-14-15-26(36(43)44)21-30(23)38-35(42)32(24-9-4-2-5-10-24)46-29-18-16-27(17-19-29)37-34(41)31(22-28-13-8-20-45-28)39-33(40)25-11-6-3-7-12-25/h2-22,32H,1H3,(H,37,41)(H,38,42)(H,39,40)(H,43,44)/b31-22- |
| InChIKey | AITYTRXDOWEBJQ-VAMRJTSQSA-N |
| XLogP | 7.17 |
| TPSA | 137.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.71 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|