C30H24ClN3O6S — CID 22187929
3-[2-[4-[[(Z)-2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4-chlorobenzoic acid (PubChem CID 22187929) has the molecular formula C30H24ClN3O6S and a molecular weight of 590.06 g/mol. Its IUPAC name is 3-[2-[4-[[(Z)-2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4-chlorobenzoic acid.
| Compound Name | 3-[2-[4-[[(Z)-2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4-chlorobenzoic acid |
|---|---|
| PubChem CID | 22187929 |
| Molecular Formula | C30H24ClN3O6S |
| Molecular Weight | 590.06 g/mol |
| Exact Mass | 589.11 |
| IUPAC Name | 3-[2-[4-[[(Z)-2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4-chlorobenzoic acid |
| SMILES | CC(Sc1ccc(NC(=O)/C(=C/c2ccco2)NC(=O)c2ccccc2)cc1)C(=O)Nc1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C30H24ClN3O6S/c1-18(27(35)33-25-16-20(30(38)39)9-14-24(25)31)41-23-12-10-21(11-13-23)32-29(37)26(17-22-8-5-15-40-22)34-28(36)19-6-3-2-4-7-19/h2-18H,1H3,(H,32,37)(H,33,35)(H,34,36)(H,38,39)/b26-17- |
| InChIKey | OGESYCONJKFWIH-ONUIUJJFSA-N |
| XLogP | 6.16 |
| TPSA | 137.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.06 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|