C36H28ClN3O5S — CID 19311410
3-[2-[3-[[(E)-2-benzamido-3-naphthalen-1-ylprop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4-chlorobenzoic acid (PubChem CID 19311410) has the molecular formula C36H28ClN3O5S and a molecular weight of 650.16 g/mol. Its IUPAC name is 3-[2-[3-[[(E)-2-benzamido-3-naphthalen-1-ylprop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4-chlorobenzoic acid.
| Compound Name | 3-[2-[3-[[(E)-2-benzamido-3-naphthalen-1-ylprop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4-chlorobenzoic acid |
|---|---|
| PubChem CID | 19311410 |
| Molecular Formula | C36H28ClN3O5S |
| Molecular Weight | 650.16 g/mol |
| Exact Mass | 649.14 |
| IUPAC Name | 3-[2-[3-[[(E)-2-benzamido-3-naphthalen-1-ylprop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4-chlorobenzoic acid |
| SMILES | CC(Sc1cccc(NC(=O)/C(=C\c2cccc3ccccc23)NC(=O)c2ccccc2)c1)C(=O)Nc1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C36H28ClN3O5S/c1-22(33(41)39-31-20-26(36(44)45)17-18-30(31)37)46-28-15-8-14-27(21-28)38-35(43)32(40-34(42)24-10-3-2-4-11-24)19-25-13-7-12-23-9-5-6-16-29(23)25/h2-22H,1H3,(H,38,43)(H,39,41)(H,40,42)(H,44,45)/b32-19+ |
| InChIKey | GKMUPVPBHXOEBT-BIZUNTBRSA-N |
| XLogP | 7.72 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.16 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|