C33H27Cl2N3O5S — CID 19306525
3-[2-[3-[[(E)-2-benzamido-3-(2,3-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4-methylbenzoic acid (PubChem CID 19306525) has the molecular formula C33H27Cl2N3O5S and a molecular weight of 648.57 g/mol. Its IUPAC name is 3-[2-[3-[[(E)-2-benzamido-3-(2,3-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4-methylbenzoic acid.
| Compound Name | 3-[2-[3-[[(E)-2-benzamido-3-(2,3-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 19306525 |
| Molecular Formula | C33H27Cl2N3O5S |
| Molecular Weight | 648.57 g/mol |
| Exact Mass | 647.10 |
| IUPAC Name | 3-[2-[3-[[(E)-2-benzamido-3-(2,3-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1NC(=O)C(C)Sc1cccc(NC(=O)/C(=C\c2cccc(Cl)c2Cl)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C33H27Cl2N3O5S/c1-19-14-15-23(33(42)43)17-27(19)37-30(39)20(2)44-25-12-7-11-24(18-25)36-32(41)28(16-22-10-6-13-26(34)29(22)35)38-31(40)21-8-4-3-5-9-21/h3-18,20H,1-2H3,(H,36,41)(H,37,39)(H,38,40)(H,42,43)/b28-16+ |
| InChIKey | JPGMTPQMICNZOR-LQKURTRISA-N |
| XLogP | 7.53 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.57 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|