C35H27Cl2N3O3S — CID 19311372
N-[(E)-3-[3-[1-(3,5-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19311372) has the molecular formula C35H27Cl2N3O3S and a molecular weight of 640.59 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-(3,5-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-(3,5-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19311372 |
| Molecular Formula | C35H27Cl2N3O3S |
| Molecular Weight | 640.59 g/mol |
| Exact Mass | 639.12 |
| IUPAC Name | N-[(E)-3-[3-[1-(3,5-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CC(Sc1cccc(NC(=O)/C(=C\c2cccc3ccccc23)NC(=O)c2ccccc2)c1)C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C35H27Cl2N3O3S/c1-22(33(41)39-29-19-26(36)18-27(37)20-29)44-30-15-8-14-28(21-30)38-35(43)32(40-34(42)24-10-3-2-4-11-24)17-25-13-7-12-23-9-5-6-16-31(23)25/h2-22H,1H3,(H,38,43)(H,39,41)(H,40,42)/b32-17+ |
| InChIKey | BCNPFCGGWQRBDA-VTNSRFBWSA-N |
| XLogP | 8.68 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.59 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|