C30H20F7N3O4S — CID 22187937
N-[(Z)-1-(furan-2-yl)-3-oxo-3-[4-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]propan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 22187937) has the molecular formula C30H20F7N3O4S and a molecular weight of 651.56 g/mol. Its IUPAC name is N-[(Z)-1-(furan-2-yl)-3-oxo-3-[4-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]propan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(furan-2-yl)-3-oxo-3-[4-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]propan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22187937 |
| Molecular Formula | C30H20F7N3O4S |
| Molecular Weight | 651.56 g/mol |
| Exact Mass | 651.11 |
| IUPAC Name | N-[(Z)-1-(furan-2-yl)-3-oxo-3-[4-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]propan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | CC(Sc1ccc(NC(=O)/C(=C/c2ccco2)NC(=O)c2ccccc2)cc1)C(=O)Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C30H20F7N3O4S/c1-15(27(41)40-26-24(33)22(31)21(30(35,36)37)23(32)25(26)34)45-19-11-9-17(10-12-19)38-29(43)20(14-18-8-5-13-44-18)39-28(42)16-6-3-2-4-7-16/h2-15H,1H3,(H,38,43)(H,39,42)(H,40,41)/b20-14- |
| InChIKey | HPSXXMONLBIRIR-ZHZULCJRSA-N |
| XLogP | 7.38 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.56 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|