C34H26F7N3O4S — CID 19309690
N-[(E)-1-(2-ethoxyphenyl)-3-oxo-3-[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]propan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19309690) has the molecular formula C34H26F7N3O4S and a molecular weight of 705.65 g/mol. Its IUPAC name is N-[(E)-1-(2-ethoxyphenyl)-3-oxo-3-[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]propan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(2-ethoxyphenyl)-3-oxo-3-[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]propan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19309690 |
| Molecular Formula | C34H26F7N3O4S |
| Molecular Weight | 705.65 g/mol |
| Exact Mass | 705.15 |
| IUPAC Name | N-[(E)-1-(2-ethoxyphenyl)-3-oxo-3-[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]propan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | CCOc1ccccc1/C=C(/NC(=O)c1ccccc1)C(=O)Nc1cccc(SC(C)C(=O)Nc2c(F)c(F)c(C(F)(F)F)c(F)c2F)c1 |
| InChI | InChI=1S/C34H26F7N3O4S/c1-3-48-24-15-8-7-12-20(24)16-23(43-32(46)19-10-5-4-6-11-19)33(47)42-21-13-9-14-22(17-21)49-18(2)31(45)44-30-28(37)26(35)25(34(39,40)41)27(36)29(30)38/h4-18H,3H2,1-2H3,(H,42,47)(H,43,46)(H,44,45)/b23-16+ |
| InChIKey | KNPOUKWTXBCIGR-XQNSMLJCSA-N |
| XLogP | 8.19 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.65 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|