C34H26F7N3O3S — CID 19313290
N-[(Z)-1-(2-methylphenyl)-3-oxo-3-[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19313290) has the molecular formula C34H26F7N3O3S and a molecular weight of 689.65 g/mol. Its IUPAC name is N-[(Z)-1-(2-methylphenyl)-3-oxo-3-[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2-methylphenyl)-3-oxo-3-[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19313290 |
| Molecular Formula | C34H26F7N3O3S |
| Molecular Weight | 689.65 g/mol |
| Exact Mass | 689.16 |
| IUPAC Name | N-[(Z)-1-(2-methylphenyl)-3-oxo-3-[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C/c2ccccc2C)NC(=O)c2ccccc2)c1)C(=O)Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C34H26F7N3O3S/c1-3-24(33(47)44-30-28(37)26(35)25(34(39,40)41)27(36)29(30)38)48-22-15-9-14-21(17-22)42-32(46)23(16-20-13-8-7-10-18(20)2)43-31(45)19-11-5-4-6-12-19/h4-17,24H,3H2,1-2H3,(H,42,46)(H,43,45)(H,44,47)/b23-16- |
| InChIKey | FPTMBHYOFIJEOS-KQWNVCNZSA-N |
| XLogP | 8.49 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.65 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|