C35H28F7N3O4S — CID 19310122
N-[(E)-1-(4-ethoxyphenyl)-3-oxo-3-[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19310122) has the molecular formula C35H28F7N3O4S and a molecular weight of 719.68 g/mol. Its IUPAC name is N-[(E)-1-(4-ethoxyphenyl)-3-oxo-3-[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(4-ethoxyphenyl)-3-oxo-3-[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19310122 |
| Molecular Formula | C35H28F7N3O4S |
| Molecular Weight | 719.68 g/mol |
| Exact Mass | 719.17 |
| IUPAC Name | N-[(E)-1-(4-ethoxyphenyl)-3-oxo-3-[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | CCOc1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SC(CC)C(=O)Nc3c(F)c(F)c(C(F)(F)F)c(F)c3F)c2)cc1 |
| InChI | InChI=1S/C35H28F7N3O4S/c1-3-25(34(48)45-31-29(38)27(36)26(35(40,41)42)28(37)30(31)39)50-23-12-8-11-21(18-23)43-33(47)24(44-32(46)20-9-6-5-7-10-20)17-19-13-15-22(16-14-19)49-4-2/h5-18,25H,3-4H2,1-2H3,(H,43,47)(H,44,46)(H,45,48)/b24-17+ |
| InChIKey | FABWUYUBDHSKBS-JJIBRWJFSA-N |
| XLogP | 8.58 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.68 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|