C35H32ClN3O6S — CID 19310114
3-[2-[3-[[(E)-2-benzamido-3-(4-ethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4-chlorobenzoic acid (PubChem CID 19310114) has the molecular formula C35H32ClN3O6S and a molecular weight of 658.18 g/mol. Its IUPAC name is 3-[2-[3-[[(E)-2-benzamido-3-(4-ethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4-chlorobenzoic acid.
| Compound Name | 3-[2-[3-[[(E)-2-benzamido-3-(4-ethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4-chlorobenzoic acid |
|---|---|
| PubChem CID | 19310114 |
| Molecular Formula | C35H32ClN3O6S |
| Molecular Weight | 658.18 g/mol |
| Exact Mass | 657.17 |
| IUPAC Name | 3-[2-[3-[[(E)-2-benzamido-3-(4-ethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4-chlorobenzoic acid |
| SMILES | CCOc1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SC(CC)C(=O)Nc3cc(C(=O)O)ccc3Cl)c2)cc1 |
| InChI | InChI=1S/C35H32ClN3O6S/c1-3-31(34(42)38-29-20-24(35(43)44)15-18-28(29)36)46-27-12-8-11-25(21-27)37-33(41)30(39-32(40)23-9-6-5-7-10-23)19-22-13-16-26(17-14-22)45-4-2/h5-21,31H,3-4H2,1-2H3,(H,37,41)(H,38,42)(H,39,40)(H,43,44)/b30-19+ |
| InChIKey | ZEJNFDFDDZEGTA-NDZAJKAJSA-N |
| XLogP | 7.36 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.18 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|