C33H27ClN4O7S — CID 19306370
3-[2-[3-[[(E)-2-benzamido-3-(2-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4-chlorobenzoic acid (PubChem CID 19306370) has the molecular formula C33H27ClN4O7S and a molecular weight of 659.12 g/mol. Its IUPAC name is 3-[2-[3-[[(E)-2-benzamido-3-(2-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4-chlorobenzoic acid.
| Compound Name | 3-[2-[3-[[(E)-2-benzamido-3-(2-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4-chlorobenzoic acid |
|---|---|
| PubChem CID | 19306370 |
| Molecular Formula | C33H27ClN4O7S |
| Molecular Weight | 659.12 g/mol |
| Exact Mass | 658.13 |
| IUPAC Name | 3-[2-[3-[[(E)-2-benzamido-3-(2-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4-chlorobenzoic acid |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2ccccc2[N+](=O)[O-])NC(=O)c2ccccc2)c1)C(=O)Nc1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C33H27ClN4O7S/c1-2-29(32(41)36-26-18-22(33(42)43)15-16-25(26)34)46-24-13-8-12-23(19-24)35-31(40)27(37-30(39)20-9-4-3-5-10-20)17-21-11-6-7-14-28(21)38(44)45/h3-19,29H,2H2,1H3,(H,35,40)(H,36,41)(H,37,39)(H,42,43)/b27-17+ |
| InChIKey | SRWDRECJYXMNOE-WPWMEQJKSA-N |
| XLogP | 6.87 |
| TPSA | 167.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.12 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|