C32H24F4N4O5S — CID 19306377
N-[(E)-1-(2-nitrophenyl)-3-oxo-3-[3-[1-oxo-1-(2,3,5,6-tetrafluoroanilino)butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19306377) has the molecular formula C32H24F4N4O5S and a molecular weight of 652.63 g/mol. Its IUPAC name is N-[(E)-1-(2-nitrophenyl)-3-oxo-3-[3-[1-oxo-1-(2,3,5,6-tetrafluoroanilino)butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(2-nitrophenyl)-3-oxo-3-[3-[1-oxo-1-(2,3,5,6-tetrafluoroanilino)butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19306377 |
| Molecular Formula | C32H24F4N4O5S |
| Molecular Weight | 652.63 g/mol |
| Exact Mass | 652.14 |
| IUPAC Name | N-[(E)-1-(2-nitrophenyl)-3-oxo-3-[3-[1-oxo-1-(2,3,5,6-tetrafluoroanilino)butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2ccccc2[N+](=O)[O-])NC(=O)c2ccccc2)c1)C(=O)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C32H24F4N4O5S/c1-2-26(32(43)39-29-27(35)22(33)17-23(34)28(29)36)46-21-13-8-12-20(16-21)37-31(42)24(38-30(41)18-9-4-3-5-10-18)15-19-11-6-7-14-25(19)40(44)45/h3-17,26H,2H2,1H3,(H,37,42)(H,38,41)(H,39,43)/b24-15+ |
| InChIKey | ZWONPTZXCOQMSI-BUVRLJJBSA-N |
| XLogP | 7.07 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.63 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|