C32H24F5N3O3S — CID 19310409
N-[(Z)-1-(2-fluorophenyl)-3-oxo-3-[3-[1-oxo-1-(2,3,5,6-tetrafluoroanilino)butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19310409) has the molecular formula C32H24F5N3O3S and a molecular weight of 625.62 g/mol. Its IUPAC name is N-[(Z)-1-(2-fluorophenyl)-3-oxo-3-[3-[1-oxo-1-(2,3,5,6-tetrafluoroanilino)butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2-fluorophenyl)-3-oxo-3-[3-[1-oxo-1-(2,3,5,6-tetrafluoroanilino)butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19310409 |
| Molecular Formula | C32H24F5N3O3S |
| Molecular Weight | 625.62 g/mol |
| Exact Mass | 625.15 |
| IUPAC Name | N-[(Z)-1-(2-fluorophenyl)-3-oxo-3-[3-[1-oxo-1-(2,3,5,6-tetrafluoroanilino)butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C/c2ccccc2F)NC(=O)c2ccccc2)c1)C(=O)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C32H24F5N3O3S/c1-2-26(32(43)40-29-27(36)23(34)17-24(35)28(29)37)44-21-13-8-12-20(16-21)38-31(42)25(15-19-11-6-7-14-22(19)33)39-30(41)18-9-4-3-5-10-18/h3-17,26H,2H2,1H3,(H,38,42)(H,39,41)(H,40,43)/b25-15- |
| InChIKey | DEYDJKLIKKZOGJ-MYYYXRDXSA-N |
| XLogP | 7.30 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.62 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|