C32H25F4N3O3S — CID 19304937
N-[(Z)-3-oxo-3-[3-[1-oxo-1-(2,3,5,6-tetrafluoroanilino)butan-2-yl]sulfanylanilino]-1-phenylprop-1-en-2-yl]benzamide (PubChem CID 19304937) has the molecular formula C32H25F4N3O3S and a molecular weight of 607.63 g/mol. Its IUPAC name is N-[(Z)-3-oxo-3-[3-[1-oxo-1-(2,3,5,6-tetrafluoroanilino)butan-2-yl]sulfanylanilino]-1-phenylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-oxo-3-[3-[1-oxo-1-(2,3,5,6-tetrafluoroanilino)butan-2-yl]sulfanylanilino]-1-phenylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19304937 |
| Molecular Formula | C32H25F4N3O3S |
| Molecular Weight | 607.63 g/mol |
| Exact Mass | 607.16 |
| IUPAC Name | N-[(Z)-3-oxo-3-[3-[1-oxo-1-(2,3,5,6-tetrafluoroanilino)butan-2-yl]sulfanylanilino]-1-phenylprop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C/c2ccccc2)NC(=O)c2ccccc2)c1)C(=O)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C32H25F4N3O3S/c1-2-26(32(42)39-29-27(35)23(33)18-24(34)28(29)36)43-22-15-9-14-21(17-22)37-31(41)25(16-19-10-5-3-6-11-19)38-30(40)20-12-7-4-8-13-20/h3-18,26H,2H2,1H3,(H,37,41)(H,38,40)(H,39,42)/b25-16- |
| InChIKey | YWCHCLVUDFFYPN-XYGWBWBKSA-N |
| XLogP | 7.16 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.63 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|