C39H31F4N3O4S — CID 19314729
N-[(E)-3-oxo-3-[3-[1-oxo-1-(2,3,5,6-tetrafluoroanilino)butan-2-yl]sulfanylanilino]-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19314729) has the molecular formula C39H31F4N3O4S and a molecular weight of 713.75 g/mol. Its IUPAC name is N-[(E)-3-oxo-3-[3-[1-oxo-1-(2,3,5,6-tetrafluoroanilino)butan-2-yl]sulfanylanilino]-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-oxo-3-[3-[1-oxo-1-(2,3,5,6-tetrafluoroanilino)butan-2-yl]sulfanylanilino]-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19314729 |
| Molecular Formula | C39H31F4N3O4S |
| Molecular Weight | 713.75 g/mol |
| Exact Mass | 713.20 |
| IUPAC Name | N-[(E)-3-oxo-3-[3-[1-oxo-1-(2,3,5,6-tetrafluoroanilino)butan-2-yl]sulfanylanilino]-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2ccc(OCc3ccccc3)cc2)NC(=O)c2ccccc2)c1)C(=O)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C39H31F4N3O4S/c1-2-33(39(49)46-36-34(42)30(40)22-31(41)35(36)43)51-29-15-9-14-27(21-29)44-38(48)32(45-37(47)26-12-7-4-8-13-26)20-24-16-18-28(19-17-24)50-23-25-10-5-3-6-11-25/h3-22,33H,2,23H2,1H3,(H,44,48)(H,45,47)(H,46,49)/b32-20+ |
| InChIKey | KZZRQMNQDKJGER-UZWMFBFFSA-N |
| XLogP | 8.74 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.75 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|