C39H36N4O6S2 — CID 19314728
N-[(Z)-3-oxo-3-[3-[1-oxo-1-(4-sulfamoylanilino)butan-2-yl]sulfanylanilino]-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19314728) has the molecular formula C39H36N4O6S2 and a molecular weight of 720.87 g/mol. Its IUPAC name is N-[(Z)-3-oxo-3-[3-[1-oxo-1-(4-sulfamoylanilino)butan-2-yl]sulfanylanilino]-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-oxo-3-[3-[1-oxo-1-(4-sulfamoylanilino)butan-2-yl]sulfanylanilino]-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19314728 |
| Molecular Formula | C39H36N4O6S2 |
| Molecular Weight | 720.87 g/mol |
| Exact Mass | 720.21 |
| IUPAC Name | N-[(Z)-3-oxo-3-[3-[1-oxo-1-(4-sulfamoylanilino)butan-2-yl]sulfanylanilino]-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C/c2ccc(OCc3ccccc3)cc2)NC(=O)c2ccccc2)c1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C39H36N4O6S2/c1-2-36(39(46)41-30-18-22-34(23-19-30)51(40,47)48)50-33-15-9-14-31(25-33)42-38(45)35(43-37(44)29-12-7-4-8-13-29)24-27-16-20-32(21-17-27)49-26-28-10-5-3-6-11-28/h3-25,36H,2,26H2,1H3,(H,41,46)(H,42,45)(H,43,44)(H2,40,47,48)/b35-24- |
| InChIKey | LTTMTPQVNJVSGJ-BGDIREAQSA-N |
| XLogP | 6.83 |
| TPSA | 156.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.87 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|