C36H35N3O6S — CID 19308938
ethyl 4-[2-[3-[[(E)-2-benzamido-3-(4-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]benzoate (PubChem CID 19308938) has the molecular formula C36H35N3O6S and a molecular weight of 637.76 g/mol. Its IUPAC name is ethyl 4-[2-[3-[[(E)-2-benzamido-3-(4-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]benzoate.
| Compound Name | ethyl 4-[2-[3-[[(E)-2-benzamido-3-(4-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]benzoate |
|---|---|
| PubChem CID | 19308938 |
| Molecular Formula | C36H35N3O6S |
| Molecular Weight | 637.76 g/mol |
| Exact Mass | 637.22 |
| IUPAC Name | ethyl 4-[2-[3-[[(E)-2-benzamido-3-(4-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(CC)Sc2cccc(NC(=O)/C(=C\c3ccc(OC)cc3)NC(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C36H35N3O6S/c1-4-32(35(42)37-27-18-16-26(17-19-27)36(43)45-5-2)46-30-13-9-12-28(23-30)38-34(41)31(22-24-14-20-29(44-3)21-15-24)39-33(40)25-10-7-6-8-11-25/h6-23,32H,4-5H2,1-3H3,(H,37,42)(H,38,41)(H,39,40)/b31-22+ |
| InChIKey | URMHOQNDRRERDD-DFKUXCBWSA-N |
| XLogP | 6.79 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.76 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|