C36H35N3O6S — CID 19308075
N-[(E)-3-[3-[1-(4-acetylanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(2,5-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19308075) has the molecular formula C36H35N3O6S and a molecular weight of 637.76 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-(4-acetylanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(2,5-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-(4-acetylanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(2,5-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19308075 |
| Molecular Formula | C36H35N3O6S |
| Molecular Weight | 637.76 g/mol |
| Exact Mass | 637.22 |
| IUPAC Name | N-[(E)-3-[3-[1-(4-acetylanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(2,5-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2cc(OC)ccc2OC)NC(=O)c2ccccc2)c1)C(=O)Nc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C36H35N3O6S/c1-5-33(36(43)37-27-16-14-24(15-17-27)23(2)40)46-30-13-9-12-28(22-30)38-35(42)31(39-34(41)25-10-7-6-8-11-25)21-26-20-29(44-3)18-19-32(26)45-4/h6-22,33H,5H2,1-4H3,(H,37,43)(H,38,42)(H,39,41)/b31-21+ |
| InChIKey | BXOPQPNCLMPTOJ-NJZRLIGZSA-N |
| XLogP | 6.83 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.76 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|