C37H39N3O8S — CID 19314129
N-[(E)-3-[3-[1-(3,5-dimethoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19314129) has the molecular formula C37H39N3O8S and a molecular weight of 685.80 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-(3,5-dimethoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-(3,5-dimethoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19314129 |
| Molecular Formula | C37H39N3O8S |
| Molecular Weight | 685.80 g/mol |
| Exact Mass | 685.25 |
| IUPAC Name | N-[(E)-3-[3-[1-(3,5-dimethoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2cc(OC)c(OC)cc2OC)NC(=O)c2ccccc2)c1)C(=O)Nc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C37H39N3O8S/c1-7-34(37(43)39-26-18-27(44-2)21-28(19-26)45-3)49-29-15-11-14-25(20-29)38-36(42)30(40-35(41)23-12-9-8-10-13-23)16-24-17-32(47-5)33(48-6)22-31(24)46-4/h8-22,34H,7H2,1-6H3,(H,38,42)(H,39,43)(H,40,41)/b30-16+ |
| InChIKey | XREZZDUFOZFRHU-OKCVXOCRSA-N |
| XLogP | 6.65 |
| TPSA | 133.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.80 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|