C35H34ClN3O6S — CID 19314098
N-[(E)-3-[3-[1-(3-chloroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19314098) has the molecular formula C35H34ClN3O6S and a molecular weight of 660.19 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-(3-chloroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-(3-chloroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19314098 |
| Molecular Formula | C35H34ClN3O6S |
| Molecular Weight | 660.19 g/mol |
| Exact Mass | 659.19 |
| IUPAC Name | N-[(E)-3-[3-[1-(3-chloroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2cc(OC)c(OC)cc2OC)NC(=O)c2ccccc2)c1)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C35H34ClN3O6S/c1-5-32(35(42)38-25-14-9-13-24(36)19-25)46-27-16-10-15-26(20-27)37-34(41)28(39-33(40)22-11-7-6-8-12-22)17-23-18-30(44-3)31(45-4)21-29(23)43-2/h6-21,32H,5H2,1-4H3,(H,37,41)(H,38,42)(H,39,40)/b28-17+ |
| InChIKey | YSCJCFKYIKNKLM-OGLMXYFKSA-N |
| XLogP | 7.28 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.19 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|