C36H35N3O9S — CID 19314158
5-[2-[3-[[(E)-2-benzamido-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-2-hydroxybenzoic acid (PubChem CID 19314158) has the molecular formula C36H35N3O9S and a molecular weight of 685.76 g/mol. Its IUPAC name is 5-[2-[3-[[(E)-2-benzamido-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-2-hydroxybenzoic acid.
| Compound Name | 5-[2-[3-[[(E)-2-benzamido-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 19314158 |
| Molecular Formula | C36H35N3O9S |
| Molecular Weight | 685.76 g/mol |
| Exact Mass | 685.21 |
| IUPAC Name | 5-[2-[3-[[(E)-2-benzamido-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-2-hydroxybenzoic acid |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2cc(OC)c(OC)cc2OC)NC(=O)c2ccccc2)c1)C(=O)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C36H35N3O9S/c1-5-32(35(43)38-24-14-15-28(40)26(19-24)36(44)45)49-25-13-9-12-23(18-25)37-34(42)27(39-33(41)21-10-7-6-8-11-21)16-22-17-30(47-3)31(48-4)20-29(22)46-2/h6-20,32,40H,5H2,1-4H3,(H,37,42)(H,38,43)(H,39,41)(H,44,45)/b27-16+ |
| InChIKey | ZRKPUVZSGGUSKK-JVWAILMASA-N |
| XLogP | 6.04 |
| TPSA | 172.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.76 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|