C34H31N3O7S — CID 19309550
5-[2-[3-[[(Z)-2-benzamido-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-2-hydroxybenzoic acid (PubChem CID 19309550) has the molecular formula C34H31N3O7S and a molecular weight of 625.70 g/mol. Its IUPAC name is 5-[2-[3-[[(Z)-2-benzamido-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-2-hydroxybenzoic acid.
| Compound Name | 5-[2-[3-[[(Z)-2-benzamido-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 19309550 |
| Molecular Formula | C34H31N3O7S |
| Molecular Weight | 625.70 g/mol |
| Exact Mass | 625.19 |
| IUPAC Name | 5-[2-[3-[[(Z)-2-benzamido-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-2-hydroxybenzoic acid |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C/c2cccc(OC)c2)NC(=O)c2ccccc2)c1)C(=O)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C34H31N3O7S/c1-3-30(33(41)36-24-15-16-29(38)27(20-24)34(42)43)45-26-14-8-12-23(19-26)35-32(40)28(18-21-9-7-13-25(17-21)44-2)37-31(39)22-10-5-4-6-11-22/h4-20,30,38H,3H2,1-2H3,(H,35,40)(H,36,41)(H,37,39)(H,42,43)/b28-18- |
| InChIKey | FQLJSSZYPNDMLK-VEILYXNESA-N |
| XLogP | 6.02 |
| TPSA | 154.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.70 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|