C35H33N3O5S — CID 19308939
N-[(E)-3-[3-[1-(4-acetylanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19308939) has the molecular formula C35H33N3O5S and a molecular weight of 607.73 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-(4-acetylanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-(4-acetylanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19308939 |
| Molecular Formula | C35H33N3O5S |
| Molecular Weight | 607.73 g/mol |
| Exact Mass | 607.21 |
| IUPAC Name | N-[(E)-3-[3-[1-(4-acetylanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2ccc(OC)cc2)NC(=O)c2ccccc2)c1)C(=O)Nc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C35H33N3O5S/c1-4-32(35(42)36-27-17-15-25(16-18-27)23(2)39)44-30-12-8-11-28(22-30)37-34(41)31(21-24-13-19-29(43-3)20-14-24)38-33(40)26-9-6-5-7-10-26/h5-22,32H,4H2,1-3H3,(H,36,42)(H,37,41)(H,38,40)/b31-21+ |
| InChIKey | DYDDTQRXGSESPD-NJZRLIGZSA-N |
| XLogP | 6.82 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.73 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|