C36H37N5O4S — CID 19308679
N-[(E)-3-[3-[1-(4-acetamidoanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19308679) has the molecular formula C36H37N5O4S and a molecular weight of 635.79 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-(4-acetamidoanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-(4-acetamidoanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19308679 |
| Molecular Formula | C36H37N5O4S |
| Molecular Weight | 635.79 g/mol |
| Exact Mass | 635.26 |
| IUPAC Name | N-[(E)-3-[3-[1-(4-acetamidoanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2ccc(N(C)C)cc2)NC(=O)c2ccccc2)c1)C(=O)Nc1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C36H37N5O4S/c1-5-33(36(45)38-28-18-16-27(17-19-28)37-24(2)42)46-31-13-9-12-29(23-31)39-35(44)32(40-34(43)26-10-7-6-8-11-26)22-25-14-20-30(21-15-25)41(3)4/h6-23,33H,5H2,1-4H3,(H,37,42)(H,38,45)(H,39,44)(H,40,43)/b32-22+ |
| InChIKey | KPYMQPJQWZXJSP-WEMUVCOSSA-N |
| XLogP | 6.63 |
| TPSA | 119.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.79 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|