C33H33N5O3S — CID 19319849
N-[(E)-1-[4-(dimethylamino)phenyl]-3-oxo-3-[3-[1-oxo-1-(pyridin-2-ylamino)butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19319849) has the molecular formula C33H33N5O3S and a molecular weight of 579.73 g/mol. Its IUPAC name is N-[(E)-1-[4-(dimethylamino)phenyl]-3-oxo-3-[3-[1-oxo-1-(pyridin-2-ylamino)butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-[4-(dimethylamino)phenyl]-3-oxo-3-[3-[1-oxo-1-(pyridin-2-ylamino)butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19319849 |
| Molecular Formula | C33H33N5O3S |
| Molecular Weight | 579.73 g/mol |
| Exact Mass | 579.23 |
| IUPAC Name | N-[(E)-1-[4-(dimethylamino)phenyl]-3-oxo-3-[3-[1-oxo-1-(pyridin-2-ylamino)butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2ccc(N(C)C)cc2)NC(=O)c2ccccc2)c1)C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C33H33N5O3S/c1-4-29(33(41)37-30-15-8-9-20-34-30)42-27-14-10-13-25(22-27)35-32(40)28(36-31(39)24-11-6-5-7-12-24)21-23-16-18-26(19-17-23)38(2)3/h5-22,29H,4H2,1-3H3,(H,35,40)(H,36,39)(H,34,37,41)/b28-21+ |
| InChIKey | AFEFUTHHWAWYHY-SGWCAAJKSA-N |
| XLogP | 6.07 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.73 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|