C29H25BrN4O3S2 — CID 19321503
N-[(Z)-1-(4-bromophenyl)-3-oxo-3-[3-[1-oxo-1-(1,3-thiazol-2-ylamino)butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19321503) has the molecular formula C29H25BrN4O3S2 and a molecular weight of 621.58 g/mol. Its IUPAC name is N-[(Z)-1-(4-bromophenyl)-3-oxo-3-[3-[1-oxo-1-(1,3-thiazol-2-ylamino)butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(4-bromophenyl)-3-oxo-3-[3-[1-oxo-1-(1,3-thiazol-2-ylamino)butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19321503 |
| Molecular Formula | C29H25BrN4O3S2 |
| Molecular Weight | 621.58 g/mol |
| Exact Mass | 620.06 |
| IUPAC Name | N-[(Z)-1-(4-bromophenyl)-3-oxo-3-[3-[1-oxo-1-(1,3-thiazol-2-ylamino)butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C/c2ccc(Br)cc2)NC(=O)c2ccccc2)c1)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C29H25BrN4O3S2/c1-2-25(28(37)34-29-31-15-16-38-29)39-23-10-6-9-22(18-23)32-27(36)24(17-19-11-13-21(30)14-12-19)33-26(35)20-7-4-3-5-8-20/h3-18,25H,2H2,1H3,(H,32,36)(H,33,35)(H,31,34,37)/b24-17- |
| InChIKey | PQGBKDAQTOQOLF-ULJHMMPZSA-N |
| XLogP | 6.82 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.58 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|