C27H21BrN4O3S2 — CID 19321413
N-[(E)-1-(3-bromophenyl)-3-oxo-3-[3-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19321413) has the molecular formula C27H21BrN4O3S2 and a molecular weight of 593.53 g/mol. Its IUPAC name is N-[(E)-1-(3-bromophenyl)-3-oxo-3-[3-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(3-bromophenyl)-3-oxo-3-[3-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19321413 |
| Molecular Formula | C27H21BrN4O3S2 |
| Molecular Weight | 593.53 g/mol |
| Exact Mass | 592.02 |
| IUPAC Name | N-[(E)-1-(3-bromophenyl)-3-oxo-3-[3-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1cccc(NC(=O)/C(=C\c2cccc(Br)c2)NC(=O)c2ccccc2)c1)Nc1nccs1 |
| InChI | InChI=1S/C27H21BrN4O3S2/c28-20-9-4-6-18(14-20)15-23(31-25(34)19-7-2-1-3-8-19)26(35)30-21-10-5-11-22(16-21)37-17-24(33)32-27-29-12-13-36-27/h1-16H,17H2,(H,30,35)(H,31,34)(H,29,32,33)/b23-15+ |
| InChIKey | COSNXIJUFSJCQP-HZHRSRAPSA-N |
| XLogP | 6.05 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.53 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|