C30H27N5O5S2 — CID 19320653
N-[(E)-3-[3-[1-[(4-methyl-1,3-thiazol-2-yl)amino]-1-oxobutan-2-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19320653) has the molecular formula C30H27N5O5S2 and a molecular weight of 601.71 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-[(4-methyl-1,3-thiazol-2-yl)amino]-1-oxobutan-2-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-[(4-methyl-1,3-thiazol-2-yl)amino]-1-oxobutan-2-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19320653 |
| Molecular Formula | C30H27N5O5S2 |
| Molecular Weight | 601.71 g/mol |
| Exact Mass | 601.15 |
| IUPAC Name | N-[(E)-3-[3-[1-[(4-methyl-1,3-thiazol-2-yl)amino]-1-oxobutan-2-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2ccc([N+](=O)[O-])cc2)NC(=O)c2ccccc2)c1)C(=O)Nc1nc(C)cs1 |
| InChI | InChI=1S/C30H27N5O5S2/c1-3-26(29(38)34-30-31-19(2)18-41-30)42-24-11-7-10-22(17-24)32-28(37)25(33-27(36)21-8-5-4-6-9-21)16-20-12-14-23(15-13-20)35(39)40/h4-18,26H,3H2,1-2H3,(H,32,37)(H,33,36)(H,31,34,38)/b25-16+ |
| InChIKey | GKYBBXZZPLHRDY-PCLIKHOPSA-N |
| XLogP | 6.28 |
| TPSA | 143.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.71 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|