C33H31N5O7S2 — CID 19320638
ethyl 2-[2-[2-[3-[[(E)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-1,3-thiazol-4-yl]acetate (PubChem CID 19320638) has the molecular formula C33H31N5O7S2 and a molecular weight of 673.77 g/mol. Its IUPAC name is ethyl 2-[2-[2-[3-[[(E)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[3-[[(E)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 19320638 |
| Molecular Formula | C33H31N5O7S2 |
| Molecular Weight | 673.77 g/mol |
| Exact Mass | 673.17 |
| IUPAC Name | ethyl 2-[2-[2-[3-[[(E)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)C(CC)Sc2cccc(NC(=O)/C(=C\c3ccc([N+](=O)[O-])cc3)NC(=O)c3ccccc3)c2)n1 |
| InChI | InChI=1S/C33H31N5O7S2/c1-3-28(32(42)37-33-35-24(20-46-33)19-29(39)45-4-2)47-26-12-8-11-23(18-26)34-31(41)27(36-30(40)22-9-6-5-7-10-22)17-21-13-15-25(16-14-21)38(43)44/h5-18,20,28H,3-4,19H2,1-2H3,(H,34,41)(H,36,40)(H,35,37,42)/b27-17+ |
| InChIKey | NQWZLXGACFTQOF-WPWMEQJKSA-N |
| XLogP | 6.08 |
| TPSA | 169.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.77 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|