C33H31BrN4O5S2 — CID 19321430
ethyl 2-[2-[2-[3-[[(E)-2-benzamido-3-(3-bromophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-1,3-thiazol-4-yl]acetate (PubChem CID 19321430) has the molecular formula C33H31BrN4O5S2 and a molecular weight of 707.67 g/mol. Its IUPAC name is ethyl 2-[2-[2-[3-[[(E)-2-benzamido-3-(3-bromophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[3-[[(E)-2-benzamido-3-(3-bromophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 19321430 |
| Molecular Formula | C33H31BrN4O5S2 |
| Molecular Weight | 707.67 g/mol |
| Exact Mass | 706.09 |
| IUPAC Name | ethyl 2-[2-[2-[3-[[(E)-2-benzamido-3-(3-bromophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)C(CC)Sc2cccc(NC(=O)/C(=C\c3cccc(Br)c3)NC(=O)c3ccccc3)c2)n1 |
| InChI | InChI=1S/C33H31BrN4O5S2/c1-3-28(32(42)38-33-36-25(20-44-33)19-29(39)43-4-2)45-26-15-9-14-24(18-26)35-31(41)27(17-21-10-8-13-23(34)16-21)37-30(40)22-11-6-5-7-12-22/h5-18,20,28H,3-4,19H2,1-2H3,(H,35,41)(H,37,40)(H,36,38,42)/b27-17+ |
| InChIKey | DSLANBWJSUILFC-WPWMEQJKSA-N |
| XLogP | 6.93 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.67 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|