C34H34N4O6S2 — CID 19320098
ethyl 2-[2-[2-[3-[[(E)-2-benzamido-3-(2-ethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-1,3-thiazol-4-yl]acetate (PubChem CID 19320098) has the molecular formula C34H34N4O6S2 and a molecular weight of 658.80 g/mol. Its IUPAC name is ethyl 2-[2-[2-[3-[[(E)-2-benzamido-3-(2-ethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[3-[[(E)-2-benzamido-3-(2-ethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 19320098 |
| Molecular Formula | C34H34N4O6S2 |
| Molecular Weight | 658.80 g/mol |
| Exact Mass | 658.19 |
| IUPAC Name | ethyl 2-[2-[2-[3-[[(E)-2-benzamido-3-(2-ethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)C(C)Sc2cccc(NC(=O)/C(=C\c3ccccc3OCC)NC(=O)c3ccccc3)c2)n1 |
| InChI | InChI=1S/C34H34N4O6S2/c1-4-43-29-17-10-9-14-24(29)18-28(37-32(41)23-12-7-6-8-13-23)33(42)35-25-15-11-16-27(19-25)46-22(3)31(40)38-34-36-26(21-45-34)20-30(39)44-5-2/h6-19,21-22H,4-5,20H2,1-3H3,(H,35,42)(H,37,41)(H,36,38,40)/b28-18+ |
| InChIKey | SSUYXPWBFNRGOA-MTDXEUNCSA-N |
| XLogP | 6.18 |
| TPSA | 135.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.80 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|