C35H36N4O6S2 — CID 19320206
ethyl 2-[2-[2-[3-[[(E)-2-benzamido-3-(4-ethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-1,3-thiazol-4-yl]acetate (PubChem CID 19320206) has the molecular formula C35H36N4O6S2 and a molecular weight of 672.83 g/mol. Its IUPAC name is ethyl 2-[2-[2-[3-[[(E)-2-benzamido-3-(4-ethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[3-[[(E)-2-benzamido-3-(4-ethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 19320206 |
| Molecular Formula | C35H36N4O6S2 |
| Molecular Weight | 672.83 g/mol |
| Exact Mass | 672.21 |
| IUPAC Name | ethyl 2-[2-[2-[3-[[(E)-2-benzamido-3-(4-ethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)C(CC)Sc2cccc(NC(=O)/C(=C\c3ccc(OCC)cc3)NC(=O)c3ccccc3)c2)n1 |
| InChI | InChI=1S/C35H36N4O6S2/c1-4-30(34(43)39-35-37-26(22-46-35)21-31(40)45-6-3)47-28-14-10-13-25(20-28)36-33(42)29(38-32(41)24-11-8-7-9-12-24)19-23-15-17-27(18-16-23)44-5-2/h7-20,22,30H,4-6,21H2,1-3H3,(H,36,42)(H,38,41)(H,37,39,43)/b29-19+ |
| InChIKey | HSFOEDPZUQAIJG-VUTHCHCSSA-N |
| XLogP | 6.57 |
| TPSA | 135.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.83 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|