C32H29ClN4O5S2 — CID 19713616
ethyl 2-[2-[2-[4-[[(Z)-2-benzamido-3-(4-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-1,3-thiazol-4-yl]acetate (PubChem CID 19713616) has the molecular formula C32H29ClN4O5S2 and a molecular weight of 649.19 g/mol. Its IUPAC name is ethyl 2-[2-[2-[4-[[(Z)-2-benzamido-3-(4-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[4-[[(Z)-2-benzamido-3-(4-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 19713616 |
| Molecular Formula | C32H29ClN4O5S2 |
| Molecular Weight | 649.19 g/mol |
| Exact Mass | 648.13 |
| IUPAC Name | ethyl 2-[2-[2-[4-[[(Z)-2-benzamido-3-(4-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)C(C)Sc2ccc(NC(=O)/C(=C/c3ccc(Cl)cc3)NC(=O)c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C32H29ClN4O5S2/c1-3-42-28(38)18-25-19-43-32(35-25)37-29(39)20(2)44-26-15-13-24(14-16-26)34-31(41)27(17-21-9-11-23(33)12-10-21)36-30(40)22-7-5-4-6-8-22/h4-17,19-20H,3,18H2,1-2H3,(H,34,41)(H,36,40)(H,35,37,39)/b27-17- |
| InChIKey | IUIJVVCBQQZRME-PKAZHMFMSA-N |
| XLogP | 6.43 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.19 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|