C28H24N4O6S2 — CID 19298580
ethyl 2-[2-[[2-[3-[(4-nitrobenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]-1,3-thiazol-4-yl]acetate (PubChem CID 19298580) has the molecular formula C28H24N4O6S2 and a molecular weight of 576.66 g/mol. Its IUPAC name is ethyl 2-[2-[[2-[3-[(4-nitrobenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[[2-[3-[(4-nitrobenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 19298580 |
| Molecular Formula | C28H24N4O6S2 |
| Molecular Weight | 576.66 g/mol |
| Exact Mass | 576.11 |
| IUPAC Name | ethyl 2-[2-[[2-[3-[(4-nitrobenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)C(Sc2cccc(NC(=O)c3ccc([N+](=O)[O-])cc3)c2)c2ccccc2)n1 |
| InChI | InChI=1S/C28H24N4O6S2/c1-2-38-24(33)16-21-17-39-28(30-21)31-27(35)25(18-7-4-3-5-8-18)40-23-10-6-9-20(15-23)29-26(34)19-11-13-22(14-12-19)32(36)37/h3-15,17,25H,2,16H2,1H3,(H,29,34)(H,30,31,35) |
| InChIKey | JKMAAILXJZHWJZ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 140.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.66 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|