C20H18N4O4S2 — CID 19298541
N-[3-[1-[(4-methyl-1,3-thiazol-2-yl)amino]-1-oxopropan-2-yl]sulfanylphenyl]-4-nitrobenzamide (PubChem CID 19298541) has the molecular formula C20H18N4O4S2 and a molecular weight of 442.52 g/mol. Its IUPAC name is N-[3-[1-[(4-methyl-1,3-thiazol-2-yl)amino]-1-oxopropan-2-yl]sulfanylphenyl]-4-nitrobenzamide.
| Compound Name | N-[3-[1-[(4-methyl-1,3-thiazol-2-yl)amino]-1-oxopropan-2-yl]sulfanylphenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 19298541 |
| Molecular Formula | C20H18N4O4S2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | N-[3-[1-[(4-methyl-1,3-thiazol-2-yl)amino]-1-oxopropan-2-yl]sulfanylphenyl]-4-nitrobenzamide |
| SMILES | Cc1csc(NC(=O)C(C)Sc2cccc(NC(=O)c3ccc([N+](=O)[O-])cc3)c2)n1 |
| InChI | InChI=1S/C20H18N4O4S2/c1-12-11-29-20(21-12)23-18(25)13(2)30-17-5-3-4-15(10-17)22-19(26)14-6-8-16(9-7-14)24(27)28/h3-11,13H,1-2H3,(H,22,26)(H,21,23,25) |
| InChIKey | PXFTUOAIALSZEK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|