C23H19N3O7S — CID 18905317
2-hydroxy-5-[2-[3-[(4-nitrobenzoyl)amino]phenyl]sulfanylpropanoylamino]benzoic acid (PubChem CID 18905317) has the molecular formula C23H19N3O7S and a molecular weight of 481.49 g/mol. Its IUPAC name is 2-hydroxy-5-[2-[3-[(4-nitrobenzoyl)amino]phenyl]sulfanylpropanoylamino]benzoic acid.
| Compound Name | 2-hydroxy-5-[2-[3-[(4-nitrobenzoyl)amino]phenyl]sulfanylpropanoylamino]benzoic acid |
|---|---|
| PubChem CID | 18905317 |
| Molecular Formula | C23H19N3O7S |
| Molecular Weight | 481.49 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | 2-hydroxy-5-[2-[3-[(4-nitrobenzoyl)amino]phenyl]sulfanylpropanoylamino]benzoic acid |
| SMILES | CC(Sc1cccc(NC(=O)c2ccc([N+](=O)[O-])cc2)c1)C(=O)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C23H19N3O7S/c1-13(21(28)24-16-7-10-20(27)19(12-16)23(30)31)34-18-4-2-3-15(11-18)25-22(29)14-5-8-17(9-6-14)26(32)33/h2-13,27H,1H3,(H,24,28)(H,25,29)(H,30,31) |
| InChIKey | CDMDAZQVBOJJHF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 158.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|